About hexanamide
hexanamide (PubChem CID 12332) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is hexanamide.
Molecular Properties
| Compound Name | hexanamide |
| PubChem CID | 12332 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | hexanamide |
| SMILES | CCCCCC(N)=O |
| InChI | InChI=1S/C6H13NO/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H2,7,8) |
| InChIKey | ALBYIUDWACNRRB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanamide?
The IUPAC name of hexanamide (CID 12332) is hexanamide.
What is the SMILES notation for hexanamide?
The canonical SMILES for hexanamide is CCCCCC(N)=O.
What is the InChIKey of hexanamide?
The InChIKey is ALBYIUDWACNRRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H2,7,8).
What are the key properties of hexanamide?
hexanamide has a molecular weight of 115.18 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexanamide is sourced from PubChem (CID 12332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).