C5H12N6O2 — CID 123320381
[2-(carbamoylhydrazinylidene)propylamino]urea (PubChem CID 123320381) has the molecular formula C5H12N6O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is [2-(carbamoylhydrazinylidene)propylamino]urea.
| Compound Name | [2-(carbamoylhydrazinylidene)propylamino]urea |
|---|---|
| PubChem CID | 123320381 |
| Molecular Formula | C5H12N6O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [2-(carbamoylhydrazinylidene)propylamino]urea |
| SMILES | CC(CNNC(N)=O)=NNC(N)=O |
| InChI | InChI=1S/C5H12N6O2/c1-3(9-11-5(7)13)2-8-10-4(6)12/h8H,2H2,1H3,(H3,6,10,12)(H3,7,11,13) |
| InChIKey | SHDCOHABLJNIQM-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|