C27H38N3O2+ — CID 123321110
hydroxy-dimethyl-[6-methyl-5-(pyridin-3-ylmethylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]azanium (PubChem CID 123321110) has the molecular formula C27H38N3O2+ and a molecular weight of 436.62 g/mol. Its IUPAC name is hydroxy-dimethyl-[6-methyl-5-(pyridin-3-ylmethylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]azanium.
| Compound Name | hydroxy-dimethyl-[6-methyl-5-(pyridin-3-ylmethylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]azanium |
|---|---|
| PubChem CID | 123321110 |
| Molecular Formula | C27H38N3O2+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | hydroxy-dimethyl-[6-methyl-5-(pyridin-3-ylmethylamino)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-yl]azanium |
| SMILES | CC12CC=C3C=C4CCC([N+](C)(C)O)CC45CCC3(O5)C1CCC2NCc1cccnc1 |
| InChI | InChI=1S/C27H38N3O2/c1-25-11-10-21-15-20-6-7-22(30(2,3)31)16-26(20)12-13-27(21,32-26)23(25)8-9-24(25)29-18-19-5-4-14-28-17-19/h4-5,10,14-15,17,22-24,29,31H,6-9,11-13,16,18H2,1-3H3/q+1 |
| InChIKey | ZTSNOLLOYREUHD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|