C30H34N2O — CID 134506417
7-[(2R,6R,14R,16R)-14-(aziridin-1-yl)-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-yl]isoquinoline (PubChem CID 134506417) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is 7-[(2R,6R,14R,16R)-14-(aziridin-1-yl)-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-yl]isoquinoline.
| Compound Name | 7-[(2R,6R,14R,16R)-14-(aziridin-1-yl)-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-yl]isoquinoline |
|---|---|
| PubChem CID | 134506417 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 7-[(2R,6R,14R,16R)-14-(aziridin-1-yl)-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-5-yl]isoquinoline |
| SMILES | C[C@]12CC=C3C=C4CC[C@@H](N5CC5)C[C@]45CCC3(O5)[C@@H]1CCC2c1ccc2ccncc2c1 |
| InChI | InChI=1S/C30H34N2O/c1-28-10-8-24-17-23-4-5-25(32-14-15-32)18-29(23)11-12-30(24,33-29)27(28)7-6-26(28)21-3-2-20-9-13-31-19-22(20)16-21/h2-3,8-9,13,16-17,19,25-27H,4-7,10-12,14-15,18H2,1H3/t25-,26?,27-,28-,29-,30?/m1/s1 |
| InChIKey | PDDXOYMKGXUQCU-TUBFSJKGSA-N |
| XLogP | 6.16 |
| TPSA | 25.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|