C20H21N3O4 — CID 123321223
phenyl N-[3-(2-hydroxy-2-methylpropoxy)-1-phenylpyrazol-5-yl]carbamate (PubChem CID 123321223) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is phenyl N-[3-(2-hydroxy-2-methylpropoxy)-1-phenylpyrazol-5-yl]carbamate.
| Compound Name | phenyl N-[3-(2-hydroxy-2-methylpropoxy)-1-phenylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 123321223 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | phenyl N-[3-(2-hydroxy-2-methylpropoxy)-1-phenylpyrazol-5-yl]carbamate |
| SMILES | CC(C)(O)COc1cc(NC(=O)Oc2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N3O4/c1-20(2,25)14-26-18-13-17(23(22-18)15-9-5-3-6-10-15)21-19(24)27-16-11-7-4-8-12-16/h3-13,25H,14H2,1-2H3,(H,21,24) |
| InChIKey | JCRHUYIQIMVXPI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |