C26H35N3O4Si — CID 89189356
phenyl N-[3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]carbamate (PubChem CID 89189356) has the molecular formula C26H35N3O4Si and a molecular weight of 481.67 g/mol. Its IUPAC name is phenyl N-[3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]carbamate.
| Compound Name | phenyl N-[3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 89189356 |
| Molecular Formula | C26H35N3O4Si |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | phenyl N-[3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]carbamate |
| SMILES | Cc1c(OC[C@H](C)O[Si](C)(C)C(C)(C)C)nn(-c2ccccc2)c1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H35N3O4Si/c1-19(33-34(6,7)26(3,4)5)18-31-24-20(2)23(29(28-24)21-14-10-8-11-15-21)27-25(30)32-22-16-12-9-13-17-22/h8-17,19H,18H2,1-7H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | KVTAWBXATVIXEG-IBGZPJMESA-N |
| XLogP | 6.58 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|