C19H18FN3O3 — CID 118128540
phenyl N-[3-(2-fluoroethoxy)-4-methyl-1-phenylpyrazol-5-yl]carbamate (PubChem CID 118128540) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is phenyl N-[3-(2-fluoroethoxy)-4-methyl-1-phenylpyrazol-5-yl]carbamate.
| Compound Name | phenyl N-[3-(2-fluoroethoxy)-4-methyl-1-phenylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 118128540 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | phenyl N-[3-(2-fluoroethoxy)-4-methyl-1-phenylpyrazol-5-yl]carbamate |
| SMILES | Cc1c(OCCF)nn(-c2ccccc2)c1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H18FN3O3/c1-14-17(21-19(24)26-16-10-6-3-7-11-16)23(15-8-4-2-5-9-15)22-18(14)25-13-12-20/h2-11H,12-13H2,1H3,(H,21,24) |
| InChIKey | VMDQJGQJNIMGDF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |