C14H18N4O3 — CID 71041411
[3-[(2S)-2-hydroxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]urea (PubChem CID 71041411) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is [3-[(2S)-2-hydroxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]urea.
| Compound Name | [3-[(2S)-2-hydroxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 71041411 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [3-[(2S)-2-hydroxypropoxy]-4-methyl-1-phenylpyrazol-5-yl]urea |
| SMILES | Cc1c(OC[C@H](C)O)nn(-c2ccccc2)c1NC(N)=O |
| InChI | InChI=1S/C14H18N4O3/c1-9(19)8-21-13-10(2)12(16-14(15)20)18(17-13)11-6-4-3-5-7-11/h3-7,9,19H,8H2,1-2H3,(H3,15,16,20)/t9-/m0/s1 |
| InChIKey | XEMWGMCVWAACNF-VIFPVBQESA-N |
| XLogP | 1.43 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |