C9H14O — CID 123321974
1-methoxypenta-1,3-dien-3-ylcyclopropane (PubChem CID 123321974) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-methoxypenta-1,3-dien-3-ylcyclopropane.
| Compound Name | 1-methoxypenta-1,3-dien-3-ylcyclopropane |
|---|---|
| PubChem CID | 123321974 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 1-methoxypenta-1,3-dien-3-ylcyclopropane |
| SMILES | CC=C(C=COC)C1CC1 |
| InChI | InChI=1S/C9H14O/c1-3-8(6-7-10-2)9-4-5-9/h3,6-7,9H,4-5H2,1-2H3 |
| InChIKey | NOZBPTHTEPZPIZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|