C14H20ClN — CID 123323087
6-chloro-9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine (PubChem CID 123323087) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 6-chloro-9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine.
| Compound Name | 6-chloro-9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine |
|---|---|
| PubChem CID | 123323087 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-chloro-9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine |
| SMILES | CC1=C2CCC(Cl)CC2=NC2CCCCC12 |
| InChI | InChI=1S/C14H20ClN/c1-9-11-4-2-3-5-13(11)16-14-8-10(15)6-7-12(9)14/h10-11,13H,2-8H2,1H3 |
| InChIKey | NAHRUIYGTAXJFC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|