C14H21N — CID 123277860
9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine (PubChem CID 123277860) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine.
| Compound Name | 9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine |
|---|---|
| PubChem CID | 123277860 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 9-methyl-1,2,3,4,4a,5,6,7,8,9a-decahydroacridine |
| SMILES | CC1=C2CCCCC2=NC2CCCCC12 |
| InChI | InChI=1S/C14H21N/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14/h11,13H,2-9H2,1H3 |
| InChIKey | TWWVLGHGNPLIJD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |