C11H17N — CID 123324115
5-cyclopropyl-2-propyl-2,3-dihydropyridine (PubChem CID 123324115) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-cyclopropyl-2-propyl-2,3-dihydropyridine.
| Compound Name | 5-cyclopropyl-2-propyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123324115 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5-cyclopropyl-2-propyl-2,3-dihydropyridine |
| SMILES | CCCC1CC=C(C2CC2)C=N1 |
| InChI | InChI=1S/C11H17N/c1-2-3-11-7-6-10(8-12-11)9-4-5-9/h6,8-9,11H,2-5,7H2,1H3 |
| InChIKey | CBWUOWGOPLCBSN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |