C6H8N4 — CID 123324427
1-methyl-4,5-dihydropyrazolo[4,5-d]pyrimidine (PubChem CID 123324427) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is 1-methyl-4,5-dihydropyrazolo[4,5-d]pyrimidine.
| Compound Name | 1-methyl-4,5-dihydropyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 123324427 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1-methyl-4,5-dihydropyrazolo[4,5-d]pyrimidine |
| SMILES | Cn1ncc2c1C=NCN2 |
| InChI | InChI=1S/C6H8N4/c1-10-6-3-7-4-8-5(6)2-9-10/h2-3,8H,4H2,1H3 |
| InChIKey | RMVKDQDTJVGFAU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |