C33H32Cl2F3N3O4 — CID 123324583
4-[7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-6-(methyliminomethyl)-1-oxo-3,5,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-5-methoxybenzoic acid (PubChem CID 123324583) has the molecular formula C33H32Cl2F3N3O4 and a molecular weight of 662.54 g/mol. Its IUPAC name is 4-[7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-6-(methyliminomethyl)-1-oxo-3,5,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-5-methoxybenzoic acid.
| Compound Name | 4-[7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-6-(methyliminomethyl)-1-oxo-3,5,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 123324583 |
| Molecular Formula | C33H32Cl2F3N3O4 |
| Molecular Weight | 662.54 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | 4-[7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-6-(methyliminomethyl)-1-oxo-3,5,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-fluoro-5-methoxybenzoic acid |
| SMILES | C/N=C/C1(c2ccc(Cl)cc2F)C(c2cccc(Cl)c2F)C2C(=O)N(c3cc(F)c(C(=O)O)cc3OC)CN2C1CC(C)(C)C |
| InChI | InChI=1S/C33H32Cl2F3N3O4/c1-32(2,3)14-26-33(15-39-4,20-10-9-17(34)11-23(20)37)27(18-7-6-8-21(35)28(18)38)29-30(42)40(16-41(26)29)24-13-22(36)19(31(43)44)12-25(24)45-5/h6-13,15,26-27,29H,14,16H2,1-5H3,(H,43,44)/b39-15+ |
| InChIKey | SLOJZPQWLPUHOS-AATKOCIRSA-N |
| XLogP | 7.33 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|