C30H27Cl2F2N3O4 — CID 66807210
4-[(5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-1,3-dioxo-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazol-2-yl]benzoic acid (PubChem CID 66807210) has the molecular formula C30H27Cl2F2N3O4 and a molecular weight of 602.47 g/mol. Its IUPAC name is 4-[(5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-1,3-dioxo-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazol-2-yl]benzoic acid.
| Compound Name | 4-[(5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-1,3-dioxo-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 66807210 |
| Molecular Formula | C30H27Cl2F2N3O4 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 4-[(5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-1,3-dioxo-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazol-2-yl]benzoic acid |
| SMILES | CC(C)(C)C[C@@H]1N2C(=O)N(c3ccc(C(=O)O)cc3)C(=O)[C@H]2[C@H](c2cccc(Cl)c2F)[C@@]1(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C30H27Cl2F2N3O4/c1-29(2,3)14-22-30(35,19-12-9-16(31)13-21(19)33)23(18-5-4-6-20(32)24(18)34)25-26(38)36(28(41)37(22)25)17-10-7-15(8-11-17)27(39)40/h4-13,22-23,25H,14,35H2,1-3H3,(H,39,40)/t22-,23-,25+,30+/m0/s1 |
| InChIKey | KQWWZPVICNBVPU-AMKZZFPWSA-N |
| XLogP | 6.56 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|