C31H28Cl2F2N4O4 — CID 67296966
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-1-(3,4-dicarbamoylphenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid (PubChem CID 67296966) has the molecular formula C31H28Cl2F2N4O4 and a molecular weight of 629.49 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-1-(3,4-dicarbamoylphenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-1-(3,4-dicarbamoylphenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67296966 |
| Molecular Formula | C31H28Cl2F2N4O4 |
| Molecular Weight | 629.49 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-1-(3,4-dicarbamoylphenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N(c2ccc(C(N)=O)c(C(N)=O)c2)[C@@H](C(=O)O)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C31H28Cl2F2N4O4/c1-30(2,3)13-23-31(14-36,20-10-7-15(32)11-22(20)34)24(18-5-4-6-21(33)25(18)35)26(29(42)43)39(23)16-8-9-17(27(37)40)19(12-16)28(38)41/h4-12,23-24,26H,13H2,1-3H3,(H2,37,40)(H2,38,41)(H,42,43)/t23-,24-,26+,31-/m0/s1 |
| InChIKey | XSPWZZWXOTYBPG-ZWGSKESKSA-N |
| XLogP | 5.79 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |