C31H28Cl2F3N3O3 — CID 56602582
4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-1-methylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid (PubChem CID 56602582) has the molecular formula C31H28Cl2F3N3O3 and a molecular weight of 618.48 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-1-methylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid.
| Compound Name | 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-1-methylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 56602582 |
| Molecular Formula | C31H28Cl2F3N3O3 |
| Molecular Weight | 618.48 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-1-methylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid |
| SMILES | CN1[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@@H](c2cccc(Cl)c2F)[C@@H]1C(=O)Nc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C31H28Cl2F3N3O3/c1-30(2,3)14-24-31(15-37,20-11-8-16(32)12-23(20)35)25(19-6-5-7-21(33)26(19)36)27(39(24)4)28(40)38-17-9-10-18(29(41)42)22(34)13-17/h5-13,24-25,27H,14H2,1-4H3,(H,38,40)(H,41,42)/t24-,25-,27+,31-/m0/s1 |
| InChIKey | PUMATDXBZGBWOI-LJQIRTBHSA-N |
| XLogP | 7.41 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.48 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |