C30H24Cl2F4IN3O3 — CID 87378276
(2R,3S,4R,5S)-1-(6-carbamoyl-2,4-difluoro-3-iodophenyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid (PubChem CID 87378276) has the molecular formula C30H24Cl2F4IN3O3 and a molecular weight of 748.34 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-(6-carbamoyl-2,4-difluoro-3-iodophenyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5S)-1-(6-carbamoyl-2,4-difluoro-3-iodophenyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87378276 |
| Molecular Formula | C30H24Cl2F4IN3O3 |
| Molecular Weight | 748.34 g/mol |
| Exact Mass | 747.02 |
| IUPAC Name | (2R,3S,4R,5S)-1-(6-carbamoyl-2,4-difluoro-3-iodophenyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N(c2c(C(N)=O)cc(F)c(I)c2F)[C@@H](C(=O)O)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C30H24Cl2F4IN3O3/c1-29(2,3)11-20-30(12-38,16-8-7-13(31)9-18(16)33)21(14-5-4-6-17(32)22(14)35)26(28(42)43)40(20)25-15(27(39)41)10-19(34)24(37)23(25)36/h4-10,20-21,26H,11H2,1-3H3,(H2,39,41)(H,42,43)/t20-,21-,26+,30-/m0/s1 |
| InChIKey | DGAQHRJMJKPSDF-TZBJVMEKSA-N |
| XLogP | 7.58 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.34 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|