C28H33Cl2FN2O3 — CID 56966570
tert-butyl (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-1'-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 56966570) has the molecular formula C28H33Cl2FN2O3 and a molecular weight of 535.49 g/mol. Its IUPAC name is tert-butyl (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-1'-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | tert-butyl (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-1'-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 56966570 |
| Molecular Formula | C28H33Cl2FN2O3 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | tert-butyl (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-1'-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | CN1[C@@H](C(=O)OC(C)(C)C)[C@H](c2cccc(Cl)c2F)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1CC(C)(C)C |
| InChI | InChI=1S/C28H33Cl2FN2O3/c1-26(2,3)14-20-28(17-12-11-15(29)13-19(17)32-25(28)35)21(16-9-8-10-18(30)22(16)31)23(33(20)7)24(34)36-27(4,5)6/h8-13,20-21,23H,14H2,1-7H3,(H,32,35)/t20-,21+,23-,28+/m1/s1 |
| InChIKey | OYVVOZUBEAZAJX-YVFCYKQZSA-N |
| XLogP | 6.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |