C26H28Cl2FNO3 — CID 71567994
ethyl (1'S,2'S,3S,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxylate (PubChem CID 71567994) has the molecular formula C26H28Cl2FNO3 and a molecular weight of 492.42 g/mol. Its IUPAC name is ethyl (1'S,2'S,3S,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxylate.
| Compound Name | ethyl (1'S,2'S,3S,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxylate |
|---|---|
| PubChem CID | 71567994 |
| Molecular Formula | C26H28Cl2FNO3 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | ethyl (1'S,2'S,3S,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](CC(C)(C)C)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C26H28Cl2FNO3/c1-5-33-23(31)17-11-14(13-25(2,3)4)26(21(17)16-7-6-8-19(28)22(16)29)18-10-9-15(27)12-20(18)30-24(26)32/h6-10,12,14,17,21H,5,11,13H2,1-4H3,(H,30,32)/t14-,17-,21-,26+/m0/s1 |
| InChIKey | OCSOXHLOQNTDSV-FZCNHZFWSA-N |
| XLogP | 6.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |