C33H34Cl2FN3O3 — CID 58286369
(1'R,2'S,3R,4'S)-N-[4-(3-amino-3-oxopropyl)phenyl]-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxamide (PubChem CID 58286369) has the molecular formula C33H34Cl2FN3O3 and a molecular weight of 610.56 g/mol. Its IUPAC name is (1'R,2'S,3R,4'S)-N-[4-(3-amino-3-oxopropyl)phenyl]-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxamide.
| Compound Name | (1'R,2'S,3R,4'S)-N-[4-(3-amino-3-oxopropyl)phenyl]-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxamide |
|---|---|
| PubChem CID | 58286369 |
| Molecular Formula | C33H34Cl2FN3O3 |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | (1'R,2'S,3R,4'S)-N-[4-(3-amino-3-oxopropyl)phenyl]-6-chloro-2'-(3-chloro-2-fluorophenyl)-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-cyclopentane]-1'-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1C[C@@H](C(=O)Nc2ccc(CCC(N)=O)cc2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C33H34Cl2FN3O3/c1-32(2,3)17-19-15-23(30(41)38-21-11-7-18(8-12-21)9-14-27(37)40)28(22-5-4-6-25(35)29(22)36)33(19)24-13-10-20(34)16-26(24)39-31(33)42/h4-8,10-13,16,19,23,28H,9,14-15,17H2,1-3H3,(H2,37,40)(H,38,41)(H,39,42)/t19-,23+,28-,33-/m0/s1 |
| InChIKey | XXHGOGBBGTXRJT-RWRZTBHESA-N |
| XLogP | 7.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |