C31H30Cl2FN3O4 — CID 66625294
2-[4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]phenyl]acetic acid (PubChem CID 66625294) has the molecular formula C31H30Cl2FN3O4 and a molecular weight of 598.50 g/mol. Its IUPAC name is 2-[4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 66625294 |
| Molecular Formula | C31H30Cl2FN3O4 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 2-[4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]phenyl]acetic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc(CC(=O)O)cc2)[C@H](c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H30Cl2FN3O4/c1-30(2,3)15-23-31(20-12-9-17(32)14-22(20)36-29(31)41)25(19-5-4-6-21(33)26(19)34)27(37-23)28(40)35-18-10-7-16(8-11-18)13-24(38)39/h4-12,14,23,25,27,37H,13,15H2,1-3H3,(H,35,40)(H,36,41)(H,38,39)/t23-,25-,27+,31?/m0/s1 |
| InChIKey | GLTGUEZQGILHII-FBJACRBTSA-N |
| XLogP | 6.15 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |