C32H32Cl2FN3O5 — CID 66624891
4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-ethoxybenzoic acid (PubChem CID 66624891) has the molecular formula C32H32Cl2FN3O5 and a molecular weight of 628.53 g/mol. Its IUPAC name is 4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 66624891 |
| Molecular Formula | C32H32Cl2FN3O5 |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 4-[[(2'R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)C2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H32Cl2FN3O5/c1-5-43-23-13-16(29(40)41)9-12-21(23)36-28(39)27-25(18-7-6-8-20(34)26(18)35)32(24(38-27)15-31(2,3)4)19-11-10-17(33)14-22(19)37-30(32)42/h6-14,24-25,27,38H,5,15H2,1-4H3,(H,36,39)(H,37,42)(H,40,41)/t24-,25-,27+,32?/m0/s1 |
| InChIKey | ORXNMYCESBWQQS-BUVORYGASA-N |
| XLogP | 6.62 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |