C32H34Cl2FN3O4S — CID 88935155
(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[2-methoxy-4-(2-sulfanylethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 88935155) has the molecular formula C32H34Cl2FN3O4S and a molecular weight of 646.61 g/mol. Its IUPAC name is (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[2-methoxy-4-(2-sulfanylethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[2-methoxy-4-(2-sulfanylethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 88935155 |
| Molecular Formula | C32H34Cl2FN3O4S |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | (2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[2-methoxy-4-(2-sulfanylethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | COc1cc(OCCS)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H34Cl2FN3O4S/c1-31(2,3)16-25-32(20-10-8-17(33)14-23(20)37-30(32)40)26(19-6-5-7-21(34)27(19)35)28(38-25)29(39)36-22-11-9-18(42-12-13-43)15-24(22)41-4/h5-11,14-15,25-26,28,38,43H,12-13,16H2,1-4H3,(H,36,39)(H,37,40)/t25-,26-,28+,32+/m0/s1 |
| InChIKey | MODCFVOBICUSKZ-CKHSQSCFSA-N |
| XLogP | 6.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|