C32H35Cl2FN4O3 — CID 67226919
(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[4-(dimethylamino)-2-methoxyphenyl]-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 67226919) has the molecular formula C32H35Cl2FN4O3 and a molecular weight of 613.56 g/mol. Its IUPAC name is (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[4-(dimethylamino)-2-methoxyphenyl]-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[4-(dimethylamino)-2-methoxyphenyl]-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 67226919 |
| Molecular Formula | C32H35Cl2FN4O3 |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[4-(dimethylamino)-2-methoxyphenyl]-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | COc1cc(N(C)C)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)C2(C(=O)Nc3cc(Cl)ccc32)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H35Cl2FN4O3/c1-31(2,3)16-25-32(20-12-10-17(33)14-23(20)37-30(32)41)26(19-8-7-9-21(34)27(19)35)28(38-25)29(40)36-22-13-11-18(39(4)5)15-24(22)42-6/h7-15,25-26,28,38H,16H2,1-6H3,(H,36,40)(H,37,41)/t25-,26+,28+,32?/m0/s1 |
| InChIKey | LSPBQIDQSKRTDD-HBVXILMASA-N |
| XLogP | 6.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |