C35H38Cl2FN3O5 — CID 67227890
methyl 3-butoxy-4-[[(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate (PubChem CID 67227890) has the molecular formula C35H38Cl2FN3O5 and a molecular weight of 670.61 g/mol. Its IUPAC name is methyl 3-butoxy-4-[[(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate.
| Compound Name | methyl 3-butoxy-4-[[(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 67227890 |
| Molecular Formula | C35H38Cl2FN3O5 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | methyl 3-butoxy-4-[[(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]benzoate |
| SMILES | CCCCOc1cc(C(=O)OC)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)C2(C(=O)Nc3cc(Cl)ccc32)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C35H38Cl2FN3O5/c1-6-7-15-46-26-16-19(32(43)45-5)11-14-24(26)39-31(42)30-28(21-9-8-10-23(37)29(21)38)35(27(41-30)18-34(2,3)4)22-13-12-20(36)17-25(22)40-33(35)44/h8-14,16-17,27-28,30,41H,6-7,15,18H2,1-5H3,(H,39,42)(H,40,44)/t27-,28+,30+,35?/m0/s1 |
| InChIKey | VRGSHBTYEXLZRE-CFYZPXAVSA-N |
| XLogP | 7.49 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|