C32H32BrClFN3O5 — CID 53236634
methyl 4-[[(2'R,3R,3'S,5'S)-6-bromo-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate (PubChem CID 53236634) has the molecular formula C32H32BrClFN3O5 and a molecular weight of 672.98 g/mol. Its IUPAC name is methyl 4-[[(2'R,3R,3'S,5'S)-6-bromo-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate.
| Compound Name | methyl 4-[[(2'R,3R,3'S,5'S)-6-bromo-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 53236634 |
| Molecular Formula | C32H32BrClFN3O5 |
| Molecular Weight | 672.98 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | methyl 4-[[(2'R,3R,3'S,5'S)-6-bromo-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@@]3(C(=O)Nc4cc(Br)ccc43)[C@H]2c2cccc(Cl)c2F)c(OC)c1 |
| InChI | InChI=1S/C32H32BrClFN3O5/c1-31(2,3)15-24-32(19-11-10-17(33)14-22(19)37-30(32)41)25(18-7-6-8-20(34)26(18)35)27(38-24)28(39)36-21-12-9-16(29(40)43-5)13-23(21)42-4/h6-14,24-25,27,38H,15H2,1-5H3,(H,36,39)(H,37,41)/t24-,25-,27+,32+/m0/s1 |
| InChIKey | OYBLRWATCCSCJW-AWOIFXJGSA-N |
| XLogP | 6.43 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.98 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |