C31H32Cl2FN3O4 — CID 67227801
(2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[4-(2-hydroxyethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 67227801) has the molecular formula C31H32Cl2FN3O4 and a molecular weight of 600.52 g/mol. Its IUPAC name is (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[4-(2-hydroxyethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[4-(2-hydroxyethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 67227801 |
| Molecular Formula | C31H32Cl2FN3O4 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | (2'R,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-N-[4-(2-hydroxyethoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc(OCCO)cc2)[C@@H](c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H32Cl2FN3O4/c1-30(2,3)16-24-31(21-12-7-17(32)15-23(21)36-29(31)40)25(20-5-4-6-22(33)26(20)34)27(37-24)28(39)35-18-8-10-19(11-9-18)41-14-13-38/h4-12,15,24-25,27,37-38H,13-14,16H2,1-3H3,(H,35,39)(H,36,40)/t24-,25+,27+,31?/m0/s1 |
| InChIKey | JCZWYDYWXVXZMQ-SCPPFDSQSA-N |
| XLogP | 5.89 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |