C31H31Cl2FN4O5 — CID 118113690
[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-[4-(2-amino-2-oxoethoxy)phenyl]carbamate (PubChem CID 118113690) has the molecular formula C31H31Cl2FN4O5 and a molecular weight of 629.52 g/mol. Its IUPAC name is [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-[4-(2-amino-2-oxoethoxy)phenyl]carbamate.
| Compound Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-[4-(2-amino-2-oxoethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 118113690 |
| Molecular Formula | C31H31Cl2FN4O5 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-[4-(2-amino-2-oxoethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)C[C@@H]1N[C@H](OC(=O)Nc2ccc(OCC(N)=O)cc2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C31H31Cl2FN4O5/c1-30(2,3)14-23-31(20-12-7-16(32)13-22(20)37-28(31)40)25(19-5-4-6-21(33)26(19)34)27(38-23)43-29(41)36-17-8-10-18(11-9-17)42-15-24(35)39/h4-13,23,25,27,38H,14-15H2,1-3H3,(H2,35,39)(H,36,41)(H,37,40)/t23-,25-,27+,31+/m0/s1 |
| InChIKey | VFDHXRNOHUZTLQ-RXRCSWILSA-N |
| XLogP | 5.95 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |