C28H25Cl2FN4O3S — CID 118113778
[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(5-cyanothiophen-2-yl)carbamate (PubChem CID 118113778) has the molecular formula C28H25Cl2FN4O3S and a molecular weight of 587.50 g/mol. Its IUPAC name is [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(5-cyanothiophen-2-yl)carbamate.
| Compound Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(5-cyanothiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 118113778 |
| Molecular Formula | C28H25Cl2FN4O3S |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(5-cyanothiophen-2-yl)carbamate |
| SMILES | CC(C)(C)C[C@@H]1N[C@H](OC(=O)Nc2ccc(C#N)s2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H25Cl2FN4O3S/c1-27(2,3)12-20-28(17-9-7-14(29)11-19(17)33-25(28)36)22(16-5-4-6-18(30)23(16)31)24(34-20)38-26(37)35-21-10-8-15(13-32)39-21/h4-11,20,22,24,34H,12H2,1-3H3,(H,33,36)(H,35,37)/t20-,22-,24+,28+/m0/s1 |
| InChIKey | RSSHKPPICVGOBP-VAEJZQHYSA-N |
| XLogP | 7.02 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |