C30H26Cl2F2N4O3 — CID 118113769
[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-7-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyanophenyl)carbamate (PubChem CID 118113769) has the molecular formula C30H26Cl2F2N4O3 and a molecular weight of 599.47 g/mol. Its IUPAC name is [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-7-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-7-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 118113769 |
| Molecular Formula | C30H26Cl2F2N4O3 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | [(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)-7-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-yl] N-(4-cyanophenyl)carbamate |
| SMILES | CC(C)(C)C[C@@H]1N[C@H](OC(=O)Nc2ccc(C#N)cc2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1c2ccc(Cl)c1F |
| InChI | InChI=1S/C30H26Cl2F2N4O3/c1-29(2,3)13-21-30(18-11-12-20(32)24(34)25(18)38-27(30)39)22(17-5-4-6-19(31)23(17)33)26(37-21)41-28(40)36-16-9-7-15(14-35)8-10-16/h4-12,21-22,26,37H,13H2,1-3H3,(H,36,40)(H,38,39)/t21-,22-,26+,30+/m0/s1 |
| InChIKey | KFYYZYAGOAPBAG-FLDOWQSXSA-N |
| XLogP | 7.10 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |