C30H29Cl2F2N3O4S — CID 70941650
[(2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(4-methylsulfonylphenyl)carbamate (PubChem CID 70941650) has the molecular formula C30H29Cl2F2N3O4S and a molecular weight of 636.55 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(4-methylsulfonylphenyl)carbamate.
| Compound Name | [(2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(4-methylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 70941650 |
| Molecular Formula | C30H29Cl2F2N3O4S |
| Molecular Weight | 636.55 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | [(2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(4-methylsulfonylphenyl)carbamate |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](OC(=O)Nc2ccc(S(C)(=O)=O)cc2)[C@@H](c2cccc(Cl)c2F)[C@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C30H29Cl2F2N3O4S/c1-29(2,3)15-24-30(16-35,21-13-8-17(31)14-23(21)33)25(20-6-5-7-22(32)26(20)34)27(37-24)41-28(38)36-18-9-11-19(12-10-18)42(4,39)40/h5-14,24-25,27,37H,15H2,1-4H3,(H,36,38)/t24-,25-,27+,30-/m1/s1 |
| InChIKey | WNWYFCLMTKXBDX-SBWMLCTNSA-N |
| XLogP | 7.20 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |