C35H36Cl2F2N4O3 — CID 70941931
[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(1-benzoylpiperidin-4-yl)carbamate (PubChem CID 70941931) has the molecular formula C35H36Cl2F2N4O3 and a molecular weight of 669.60 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(1-benzoylpiperidin-4-yl)carbamate.
| Compound Name | [(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(1-benzoylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 70941931 |
| Molecular Formula | C35H36Cl2F2N4O3 |
| Molecular Weight | 669.60 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | [(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl] N-(1-benzoylpiperidin-4-yl)carbamate |
| SMILES | CC(C)(C)C[C@@H]1N[C@H](OC(=O)NC2CCN(C(=O)c3ccccc3)CC2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C35H36Cl2F2N4O3/c1-34(2,3)19-28-35(20-40,25-13-12-22(36)18-27(25)38)29(24-10-7-11-26(37)30(24)39)31(42-28)46-33(45)41-23-14-16-43(17-15-23)32(44)21-8-5-4-6-9-21/h4-13,18,23,28-29,31,42H,14-17,19H2,1-3H3,(H,41,45)/t28-,29-,31+,35-/m0/s1 |
| InChIKey | GCNBZZWLXYMVLF-JNHBBQSGSA-N |
| XLogP | 7.58 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.60 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |