C25H26Cl2F2N4O4 — CID 89120461
[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-(methylcarbamoyl)amino] hydrogen carbonate (PubChem CID 89120461) has the molecular formula C25H26Cl2F2N4O4 and a molecular weight of 555.41 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-(methylcarbamoyl)amino] hydrogen carbonate.
| Compound Name | [[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-(methylcarbamoyl)amino] hydrogen carbonate |
|---|---|
| PubChem CID | 89120461 |
| Molecular Formula | C25H26Cl2F2N4O4 |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | [[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidin-2-yl]-(methylcarbamoyl)amino] hydrogen carbonate |
| SMILES | CNC(=O)N(OC(=O)O)[C@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C25H26Cl2F2N4O4/c1-24(2,3)11-18-25(12-30,15-9-8-13(26)10-17(15)28)19(14-6-5-7-16(27)20(14)29)21(32-18)33(22(34)31-4)37-23(35)36/h5-10,18-19,21,32H,11H2,1-4H3,(H,31,34)(H,35,36)/t18-,19-,21+,25-/m0/s1 |
| InChIKey | GVSTZZXACJANNO-SLXNBQQMSA-N |
| XLogP | 5.80 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|