C30H36Cl2FN3O6 — CID 58710848
methyl (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(2-methoxyethoxy)ethylcarbamoyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 58710848) has the molecular formula C30H36Cl2FN3O6 and a molecular weight of 624.54 g/mol. Its IUPAC name is methyl (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(2-methoxyethoxy)ethylcarbamoyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | methyl (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(2-methoxyethoxy)ethylcarbamoyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 58710848 |
| Molecular Formula | C30H36Cl2FN3O6 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | methyl (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-5'-[2-(2-methoxyethoxy)ethylcarbamoyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | COCCOCCNC(=O)[C@H]1[C@H](c2cccc(Cl)c2F)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](CC(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C30H36Cl2FN3O6/c1-29(2,3)16-22-30(19-10-9-17(31)15-21(19)35-27(30)38)23(18-7-6-8-20(32)24(18)33)25(36(22)28(39)41-5)26(37)34-11-12-42-14-13-40-4/h6-10,15,22-23,25H,11-14,16H2,1-5H3,(H,34,37)(H,35,38)/t22-,23+,25-,30+/m1/s1 |
| InChIKey | RAAJWOJOBNKLCC-ZWXBAZLCSA-N |
| XLogP | 5.14 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|