C21H24N4O2 — CID 123324890
1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]-3-[(3-methylphenyl)methyl]imidazolidin-2-one (PubChem CID 123324890) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]-3-[(3-methylphenyl)methyl]imidazolidin-2-one.
| Compound Name | 1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]-3-[(3-methylphenyl)methyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 123324890 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]-3-[(3-methylphenyl)methyl]imidazolidin-2-one |
| SMILES | [H]/N=C/C(/C=N/[H])c1ccc(N2CCN(Cc3cccc(C)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H24N4O2/c1-15-4-3-5-16(10-15)14-24-8-9-25(21(24)26)18-6-7-19(17(12-22)13-23)20(11-18)27-2/h3-7,10-13,17,22-23H,8-9,14H2,1-2H3/b22-12+,23-13+ |
| InChIKey | PSYALHABXZIVRS-FWSOMWAYSA-N |
| XLogP | 3.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|