C34H58O2Si — CID 123326157
(5R)-3-[2-[(7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexan-1-ol (PubChem CID 123326157) has the molecular formula C34H58O2Si and a molecular weight of 526.92 g/mol. Its IUPAC name is (5R)-3-[2-[(7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexan-1-ol.
| Compound Name | (5R)-3-[2-[(7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 123326157 |
| Molecular Formula | C34H58O2Si |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.42 |
| IUPAC Name | (5R)-3-[2-[(7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CCC3[C@H](C)C=C[C@H](C)C(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC1O |
| InChI | InChI=1S/C34H58O2Si/c1-23(2)24(3)14-15-25(4)30-18-19-31-27(13-12-20-34(30,31)9)16-17-28-21-29(22-32(35)26(28)5)36-37(10,11)33(6,7)8/h14-17,23-25,29-32,35H,5,12-13,18-22H2,1-4,6-11H3/t24-,25+,29+,30?,31?,32?,34+/m0/s1 |
| InChIKey | QAGNTHOJEGTRBR-YGRRPDKGSA-N |
| XLogP | 9.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|