C18H24N4O4S — CID 123326415
[1-(4,8-dimethyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)piperidin-3-yl] methanesulfonate (PubChem CID 123326415) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is [1-(4,8-dimethyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)piperidin-3-yl] methanesulfonate.
| Compound Name | [1-(4,8-dimethyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)piperidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 123326415 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [1-(4,8-dimethyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)piperidin-3-yl] methanesulfonate |
| SMILES | CN1CCc2c(c3ccc(N4CCCC(OS(C)(=O)=O)C4)nc3n2C)C1=O |
| InChI | InChI=1S/C18H24N4O4S/c1-20-10-8-14-16(18(20)23)13-6-7-15(19-17(13)21(14)2)22-9-4-5-12(11-22)26-27(3,24)25/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | WBXVLANBGAEKLE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|