C21H16ClN3O4 — CID 123326584
N-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 123326584) has the molecular formula C21H16ClN3O4 and a molecular weight of 409.83 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 123326584 |
| Molecular Formula | C21H16ClN3O4 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-3-[3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(C=Cc1cccc(C(=O)NN=Cc2ccc(-c3cccc(Cl)c3)o2)c1)NO |
| InChI | InChI=1S/C21H16ClN3O4/c22-17-6-2-4-15(12-17)19-9-8-18(29-19)13-23-24-21(27)16-5-1-3-14(11-16)7-10-20(26)25-28/h1-13,28H,(H,24,27)(H,25,26) |
| InChIKey | FALZFPNOFOLZOL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|