C22H17ClN2O4 — CID 158513678
(E)-3-[4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]acetyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 158513678) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is (E)-3-[4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]acetyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]acetyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 158513678 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-3-[4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]acetyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)C/N=C/c2ccc(-c3cccc(Cl)c3)o2)cc1)NO |
| InChI | InChI=1S/C22H17ClN2O4/c23-18-3-1-2-17(12-18)21-10-9-19(29-21)13-24-14-20(26)16-7-4-15(5-8-16)6-11-22(27)25-28/h1-13,28H,14H2,(H,25,27)/b11-6+,24-13+ |
| InChIKey | NHXWSBGRVRWWRQ-UAYRUZORSA-N |
| XLogP | 4.42 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|