C11H13N — CID 123327530
8-methyl-4a,7-dihydro-4H-naphthalen-1-imine (PubChem CID 123327530) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 8-methyl-4a,7-dihydro-4H-naphthalen-1-imine.
| Compound Name | 8-methyl-4a,7-dihydro-4H-naphthalen-1-imine |
|---|---|
| PubChem CID | 123327530 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 8-methyl-4a,7-dihydro-4H-naphthalen-1-imine |
| SMILES | [H]/N=C1\C=CCC2C=CCC(C)=C12 |
| InChI | InChI=1S/C11H13N/c1-8-4-2-5-9-6-3-7-10(12)11(8)9/h2-3,5,7,9,12H,4,6H2,1H3/b12-10+ |
| InChIKey | IETUNLKOJFLJBK-ZRDIBKRKSA-N |
| XLogP | 2.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|