C28H32F2N4O5 — CID 123327795
tert-butyl 7-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methyl-8-oxospiro[6H-pyrrolo[2,3-c][2,7]naphthyridine-9,4'-piperidine]-1'-carboxylate (PubChem CID 123327795) has the molecular formula C28H32F2N4O5 and a molecular weight of 542.58 g/mol. Its IUPAC name is tert-butyl 7-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methyl-8-oxospiro[6H-pyrrolo[2,3-c][2,7]naphthyridine-9,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 7-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methyl-8-oxospiro[6H-pyrrolo[2,3-c][2,7]naphthyridine-9,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 123327795 |
| Molecular Formula | C28H32F2N4O5 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | tert-butyl 7-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methyl-8-oxospiro[6H-pyrrolo[2,3-c][2,7]naphthyridine-9,4'-piperidine]-1'-carboxylate |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(ccn4C)c3C3(CCN(C(=O)OC(C)(C)C)CC3)C2=O)c1F |
| InChI | InChI=1S/C28H32F2N4O5/c1-27(2,3)39-26(36)33-11-8-28(9-12-33)20-16(14-31-24-17(20)7-10-32(24)4)15-34(25(28)35)23-21(29)18(37-5)13-19(38-6)22(23)30/h7,10,13-14H,8-9,11-12,15H2,1-6H3 |
| InChIKey | PBVYKMSJYNLWRS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|