C19H21N3O5S — CID 123327911
4-methylbenzenesulfonic acid;2-nitro-4-piperidin-1-ylbenzonitrile (PubChem CID 123327911) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-nitro-4-piperidin-1-ylbenzonitrile.
| Compound Name | 4-methylbenzenesulfonic acid;2-nitro-4-piperidin-1-ylbenzonitrile |
|---|---|
| PubChem CID | 123327911 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-nitro-4-piperidin-1-ylbenzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N#Cc1ccc(N2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O2.C7H8O3S/c13-9-10-4-5-11(8-12(10)15(16)17)14-6-2-1-3-7-14;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,8H,1-3,6-7H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | GCMPKLWPKBUYKU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|