About 2-cyano-N',4-dimethyl-3-oxopentanimidamide
2-cyano-N',4-dimethyl-3-oxopentanimidamide (PubChem CID 123328316) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-cyano-N',4-dimethyl-3-oxopentanimidamide.
Molecular Properties
| Compound Name | 2-cyano-N',4-dimethyl-3-oxopentanimidamide |
| PubChem CID | 123328316 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-cyano-N',4-dimethyl-3-oxopentanimidamide |
| SMILES | C/N=C(\N)C(C#N)C(=O)C(C)C |
| InChI | InChI=1S/C8H13N3O/c1-5(2)7(12)6(4-9)8(10)11-3/h5-6H,1-3H3,(H2,10,11) |
| InChIKey | BQEMAUHFLGYOEZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N',4-dimethyl-3-oxopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N',4-dimethyl-3-oxopentanimidamide?
The IUPAC name of 2-cyano-N',4-dimethyl-3-oxopentanimidamide (CID 123328316) is 2-cyano-N',4-dimethyl-3-oxopentanimidamide.
What is the SMILES notation for 2-cyano-N',4-dimethyl-3-oxopentanimidamide?
The canonical SMILES for 2-cyano-N',4-dimethyl-3-oxopentanimidamide is C/N=C(\N)C(C#N)C(=O)C(C)C.
What is the InChIKey of 2-cyano-N',4-dimethyl-3-oxopentanimidamide?
The InChIKey is BQEMAUHFLGYOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-5(2)7(12)6(4-9)8(10)11-3/h5-6H,1-3H3,(H2,10,11).
What are the key properties of 2-cyano-N',4-dimethyl-3-oxopentanimidamide?
2-cyano-N',4-dimethyl-3-oxopentanimidamide has a molecular weight of 167.21 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N',4-dimethyl-3-oxopentanimidamide is sourced from PubChem (CID 123328316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).