C15H20N8O2 — CID 123328992
8-[4-(1-aminocyclohexyl)triazol-1-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 123328992) has the molecular formula C15H20N8O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 8-[4-(1-aminocyclohexyl)triazol-1-yl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[4-(1-aminocyclohexyl)triazol-1-yl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 123328992 |
| Molecular Formula | C15H20N8O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 8-[4-(1-aminocyclohexyl)triazol-1-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-n3cc(C4(N)CCCCC4)nn3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H20N8O2/c1-21-11-10(12(24)22(2)14(21)25)17-13(18-11)23-8-9(19-20-23)15(16)6-4-3-5-7-15/h8H,3-7,16H2,1-2H3,(H,17,18) |
| InChIKey | PAYONKAPUNBKBB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 129.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |