C15H19N7O2 — CID 67969072
8-(4-cyclohexyltriazol-1-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 67969072) has the molecular formula C15H19N7O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 8-(4-cyclohexyltriazol-1-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(4-cyclohexyltriazol-1-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67969072 |
| Molecular Formula | C15H19N7O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 8-(4-cyclohexyltriazol-1-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-n3cc(C4CCCCC4)nn3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H19N7O2/c1-20-12-11(13(23)21(2)15(20)24)16-14(17-12)22-8-10(18-19-22)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | TYUJLGCSLVSJTP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |