C37H35BNO2 — CID 123329952
CID 123329952 (PubChem CID 123329952) has the molecular formula C37H35BNO2 and a molecular weight of 536.50 g/mol.
| Compound Name | CID 123329952 |
|---|---|
| PubChem CID | 123329952 |
| Molecular Formula | C37H35BNO2 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc([B]OC(C)(C)C(C)(C)O)ccc2-n2c3ccccc3c3ccc(-c4cccc5ccccc45)c1c32 |
| InChI | InChI=1S/C37H35BNO2/c1-35(2)30-22-24(38-41-37(5,6)36(3,4)40)18-21-32(30)39-31-17-10-9-15-27(31)29-20-19-28(33(35)34(29)39)26-16-11-13-23-12-7-8-14-25(23)26/h7-22,40H,1-6H3 |
| InChIKey | GSBOIURLEQCNHP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|