C35H34BO2 — CID 153369068
CID 153369068 (PubChem CID 153369068) has the molecular formula C35H34BO2 and a molecular weight of 497.47 g/mol.
| Compound Name | CID 153369068 |
|---|---|
| PubChem CID | 153369068 |
| Molecular Formula | C35H34BO2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc(-c3ccc([B]OC(C)(C)C(C)(C)O)cc3)ccc2-c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C35H34BO2/c1-33(2)30-21-23(22-15-18-24(19-16-22)36-38-35(5,6)34(3,4)37)17-20-29(30)31-27-13-9-7-11-25(27)26-12-8-10-14-28(26)32(31)33/h7-21,37H,1-6H3 |
| InChIKey | NVVMEQCFUSPNAY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|