C26H29BNO2 — CID 142296860
CID 142296860 (PubChem CID 142296860) has the molecular formula C26H29BNO2 and a molecular weight of 398.34 g/mol.
| Compound Name | CID 142296860 |
|---|---|
| PubChem CID | 142296860 |
| Molecular Formula | C26H29BNO2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc([B]OC(C)(C)C(C)(C)O)cn3)cc21 |
| InChI | InChI=1S/C26H29BNO2/c1-24(2)21-10-8-7-9-19(21)20-13-11-17(15-22(20)24)23-14-12-18(16-28-23)27-30-26(5,6)25(3,4)29/h7-16,29H,1-6H3 |
| InChIKey | PMNZIYKXBKTGIT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|