C26H37BNO2 — CID 145132296
CID 145132296 (PubChem CID 145132296) has the molecular formula C26H37BNO2 and a molecular weight of 406.40 g/mol.
| Compound Name | CID 145132296 |
|---|---|
| PubChem CID | 145132296 |
| Molecular Formula | C26H37BNO2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(-c2ccc3c(c2)C(C)(C)C(C)(C)C3(C)C)nc1 |
| InChI | InChI=1S/C26H37BNO2/c1-22(2)19-13-11-17(15-20(19)23(3,4)24(22,5)6)21-14-12-18(16-28-21)27-30-26(9,10)25(7,8)29/h11-16,29H,1-10H3 |
| InChIKey | CSBQTULFEJGVDY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|